C23H36N2O6 — CID 175793762
ditert-butyl 2-amino-2-[4-(phenylmethoxycarbonylamino)butyl]propanedioate (PubChem CID 175793762) has the molecular formula C23H36N2O6 and a molecular weight of 436.55 g/mol. Its IUPAC name is ditert-butyl 2-amino-2-[4-(phenylmethoxycarbonylamino)butyl]propanedioate.
| Compound Name | ditert-butyl 2-amino-2-[4-(phenylmethoxycarbonylamino)butyl]propanedioate |
|---|---|
| PubChem CID | 175793762 |
| Molecular Formula | C23H36N2O6 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | ditert-butyl 2-amino-2-[4-(phenylmethoxycarbonylamino)butyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(N)(CCCCNC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H36N2O6/c1-21(2,3)30-18(26)23(24,19(27)31-22(4,5)6)14-10-11-15-25-20(28)29-16-17-12-8-7-9-13-17/h7-9,12-13H,10-11,14-16,24H2,1-6H3,(H,25,28) |
| InChIKey | VWLQOJNWLBCKMO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|