C21H33N3O6 — CID 57202383
tert-butyl 2-amino-2-[methoxy(methyl)carbamoyl]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 57202383) has the molecular formula C21H33N3O6 and a molecular weight of 423.51 g/mol. Its IUPAC name is tert-butyl 2-amino-2-[methoxy(methyl)carbamoyl]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | tert-butyl 2-amino-2-[methoxy(methyl)carbamoyl]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 57202383 |
| Molecular Formula | C21H33N3O6 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | tert-butyl 2-amino-2-[methoxy(methyl)carbamoyl]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CON(C)C(=O)C(N)(CCCCNC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H33N3O6/c1-20(2,3)30-18(26)21(22,17(25)24(4)28-5)13-9-10-14-23-19(27)29-15-16-11-7-6-8-12-16/h6-8,11-12H,9-10,13-15,22H2,1-5H3,(H,23,27) |
| InChIKey | GYCDBRYSAMLIEV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|