C27H36N2O6 — CID 149436851
3-O-tert-butyl 1-O-(3,4-dimethylphenyl) (2R)-2-amino-2-[4-(phenylmethoxycarbonylamino)butyl]propanedioate (PubChem CID 149436851) has the molecular formula C27H36N2O6 and a molecular weight of 484.59 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-(3,4-dimethylphenyl) (2R)-2-amino-2-[4-(phenylmethoxycarbonylamino)butyl]propanedioate.
| Compound Name | 3-O-tert-butyl 1-O-(3,4-dimethylphenyl) (2R)-2-amino-2-[4-(phenylmethoxycarbonylamino)butyl]propanedioate |
|---|---|
| PubChem CID | 149436851 |
| Molecular Formula | C27H36N2O6 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 3-O-tert-butyl 1-O-(3,4-dimethylphenyl) (2R)-2-amino-2-[4-(phenylmethoxycarbonylamino)butyl]propanedioate |
| SMILES | Cc1ccc(OC(=O)[C@@](N)(CCCCNC(=O)OCc2ccccc2)C(=O)OC(C)(C)C)cc1C |
| InChI | InChI=1S/C27H36N2O6/c1-19-13-14-22(17-20(19)2)34-23(30)27(28,24(31)35-26(3,4)5)15-9-10-16-29-25(32)33-18-21-11-7-6-8-12-21/h6-8,11-14,17H,9-10,15-16,18,28H2,1-5H3,(H,29,32)/t27-/m0/s1 |
| InChIKey | RAKJFBPSCOCUPG-MHZLTWQESA-N |
| XLogP | 4.34 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|