C34H41N3O6 — CID 59693752
tert-butyl N-[5-[benzyl(2-hydroxyethyl)amino]-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentyl]carbamate (PubChem CID 59693752) has the molecular formula C34H41N3O6 and a molecular weight of 587.72 g/mol. Its IUPAC name is tert-butyl N-[5-[benzyl(2-hydroxyethyl)amino]-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[5-[benzyl(2-hydroxyethyl)amino]-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 59693752 |
| Molecular Formula | C34H41N3O6 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.30 |
| IUPAC Name | tert-butyl N-[5-[benzyl(2-hydroxyethyl)amino]-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C34H41N3O6/c1-34(2,3)43-32(40)35-19-11-18-30(31(39)37(20-21-38)22-24-12-5-4-6-13-24)36-33(41)42-23-29-27-16-9-7-14-25(27)26-15-8-10-17-28(26)29/h4-10,12-17,29-30,38H,11,18-23H2,1-3H3,(H,35,40)(H,36,41) |
| InChIKey | PPCKONWGVHQSQU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|