C36H43N3O7 — CID 155933484
ethyl 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]acetate (PubChem CID 155933484) has the molecular formula C36H43N3O7 and a molecular weight of 629.75 g/mol. Its IUPAC name is ethyl 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]acetate.
| Compound Name | ethyl 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]acetate |
|---|---|
| PubChem CID | 155933484 |
| Molecular Formula | C36H43N3O7 |
| Molecular Weight | 629.75 g/mol |
| Exact Mass | 629.31 |
| IUPAC Name | ethyl 2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]acetate |
| SMILES | CCOC(=O)CN(CCCNC(=O)OC(C)(C)C)C(=O)[C@H](Cc1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C36H43N3O7/c1-5-44-32(40)23-39(21-13-20-37-34(42)46-36(2,3)4)33(41)31(22-25-14-7-6-8-15-25)38-35(43)45-24-30-28-18-11-9-16-26(28)27-17-10-12-19-29(27)30/h6-12,14-19,30-31H,5,13,20-24H2,1-4H3,(H,37,42)(H,38,43)/t31-/m0/s1 |
| InChIKey | VDDWHDXFDKWGFW-HKBQPEDESA-N |
| XLogP | 5.44 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.75 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|