C31H34N2O5 — CID 15450756
tert-butyl 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl-(2-phenylacetyl)amino]acetate (PubChem CID 15450756) has the molecular formula C31H34N2O5 and a molecular weight of 514.62 g/mol. Its IUPAC name is tert-butyl 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl-(2-phenylacetyl)amino]acetate.
| Compound Name | tert-butyl 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl-(2-phenylacetyl)amino]acetate |
|---|---|
| PubChem CID | 15450756 |
| Molecular Formula | C31H34N2O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | tert-butyl 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl-(2-phenylacetyl)amino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(CCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C31H34N2O5/c1-31(2,3)38-29(35)20-33(28(34)19-22-11-5-4-6-12-22)18-17-32-30(36)37-21-27-25-15-9-7-13-23(25)24-14-8-10-16-26(24)27/h4-16,27H,17-21H2,1-3H3,(H,32,36) |
| InChIKey | MKIWZNKOENPLJC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |