C29H37N3O7 — CID 177475678
2-[5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]acetic acid (PubChem CID 177475678) has the molecular formula C29H37N3O7 and a molecular weight of 539.63 g/mol. Its IUPAC name is 2-[5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]acetic acid.
| Compound Name | 2-[5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 177475678 |
| Molecular Formula | C29H37N3O7 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | 2-[5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]acetic acid |
| SMILES | CC(C)(C)OC(=O)NCCN(CC(=O)O)C(=O)CCCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H37N3O7/c1-29(2,3)39-28(37)31-16-17-32(18-26(34)35)25(33)14-8-9-15-30-27(36)38-19-24-22-12-6-4-10-20(22)21-11-5-7-13-23(21)24/h4-7,10-13,24H,8-9,14-19H2,1-3H3,(H,30,36)(H,31,37)(H,34,35) |
| InChIKey | KONGDIXONZUYDP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|