C22H25NO4 — CID 157220460
ethyl 5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate (PubChem CID 157220460) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is ethyl 5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate.
| Compound Name | ethyl 5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 157220460 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | ethyl 5-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate |
| SMILES | CCOC(=O)CCCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H25NO4/c1-2-26-21(24)13-7-8-14-23-22(25)27-15-20-18-11-5-3-9-16(18)17-10-4-6-12-19(17)20/h3-6,9-12,20H,2,7-8,13-15H2,1H3,(H,23,25) |
| InChIKey | UAWHZDLXLAOSSU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|