C42H44N2O7 — CID 21043295
6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate (PubChem CID 21043295) has the molecular formula C42H44N2O7 and a molecular weight of 688.82 g/mol. Its IUPAC name is 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate.
| Compound Name | 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 21043295 |
| Molecular Formula | C42H44N2O7 |
| Molecular Weight | 688.82 g/mol |
| Exact Mass | 688.31 |
| IUPAC Name | 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoyl 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
| SMILES | O=C(CCCCCNC(=O)OCC1c2ccccc2-c2ccccc21)OC(=O)CCCCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C42H44N2O7/c45-39(23-3-1-13-25-43-41(47)49-27-37-33-19-9-5-15-29(33)30-16-6-10-20-34(30)37)51-40(46)24-4-2-14-26-44-42(48)50-28-38-35-21-11-7-17-31(35)32-18-8-12-22-36(32)38/h5-12,15-22,37-38H,1-4,13-14,23-28H2,(H,43,47)(H,44,48) |
| InChIKey | WNQWZEBLMKCBBW-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.82 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|