C24H31NO3SSi — CID 57330497
O-trimethylsilyl 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanethioate (PubChem CID 57330497) has the molecular formula C24H31NO3SSi and a molecular weight of 441.67 g/mol. Its IUPAC name is O-trimethylsilyl 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanethioate.
| Compound Name | O-trimethylsilyl 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanethioate |
|---|---|
| PubChem CID | 57330497 |
| Molecular Formula | C24H31NO3SSi |
| Molecular Weight | 441.67 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | O-trimethylsilyl 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanethioate |
| SMILES | C[Si](C)(C)OC(=S)CCCCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H31NO3SSi/c1-30(2,3)28-23(29)15-5-4-10-16-25-24(26)27-17-22-20-13-8-6-11-18(20)19-12-7-9-14-21(19)22/h6-9,11-14,22H,4-5,10,15-17H2,1-3H3,(H,25,26) |
| InChIKey | IEICTZCBNJAPNW-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.67 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|