C26H39NO3Si2 — CID 158408156
9H-fluoren-9-ylmethyl N-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]carbamate (PubChem CID 158408156) has the molecular formula C26H39NO3Si2 and a molecular weight of 469.77 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]carbamate |
|---|---|
| PubChem CID | 158408156 |
| Molecular Formula | C26H39NO3Si2 |
| Molecular Weight | 469.77 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]carbamate |
| SMILES | CCCC[Si](C)(C)O[Si](C)(C)CCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H39NO3Si2/c1-6-7-18-31(2,3)30-32(4,5)19-12-17-27-26(28)29-20-25-23-15-10-8-13-21(23)22-14-9-11-16-24(22)25/h8-11,13-16,25H,6-7,12,17-20H2,1-5H3,(H,27,28) |
| InChIKey | JDJQQSJNWLSOCO-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.77 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|