C20H21NO3S — CID 23597232
S-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl] ethanethioate (PubChem CID 23597232) has the molecular formula C20H21NO3S and a molecular weight of 355.46 g/mol. Its IUPAC name is S-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl] ethanethioate.
| Compound Name | S-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl] ethanethioate |
|---|---|
| PubChem CID | 23597232 |
| Molecular Formula | C20H21NO3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | S-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propyl] ethanethioate |
| SMILES | CC(=O)SCCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H21NO3S/c1-14(22)25-12-6-11-21-20(23)24-13-19-17-9-4-2-7-15(17)16-8-3-5-10-18(16)19/h2-5,7-10,19H,6,11-13H2,1H3,(H,21,23) |
| InChIKey | ZQCLCGVAEPKRNB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|