C27H35N3O4S — CID 170367359
tert-butyl N-[6-(9H-fluoren-9-ylmethoxycarbonylcarbamothioylamino)hexyl]carbamate (PubChem CID 170367359) has the molecular formula C27H35N3O4S and a molecular weight of 497.66 g/mol. Its IUPAC name is tert-butyl N-[6-(9H-fluoren-9-ylmethoxycarbonylcarbamothioylamino)hexyl]carbamate.
| Compound Name | tert-butyl N-[6-(9H-fluoren-9-ylmethoxycarbonylcarbamothioylamino)hexyl]carbamate |
|---|---|
| PubChem CID | 170367359 |
| Molecular Formula | C27H35N3O4S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | tert-butyl N-[6-(9H-fluoren-9-ylmethoxycarbonylcarbamothioylamino)hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCNC(=S)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H35N3O4S/c1-27(2,3)34-25(31)29-17-11-5-4-10-16-28-24(35)30-26(32)33-18-23-21-14-8-6-12-19(21)20-13-7-9-15-22(20)23/h6-9,12-15,23H,4-5,10-11,16-18H2,1-3H3,(H,29,31)(H2,28,30,32,35) |
| InChIKey | GZHGYJUUHSNQCT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|