C28H37N3O4S — CID 170367360
tert-butyl N-[7-(9H-fluoren-9-ylmethoxycarbonylcarbamothioylamino)heptyl]carbamate (PubChem CID 170367360) has the molecular formula C28H37N3O4S and a molecular weight of 511.69 g/mol. Its IUPAC name is tert-butyl N-[7-(9H-fluoren-9-ylmethoxycarbonylcarbamothioylamino)heptyl]carbamate.
| Compound Name | tert-butyl N-[7-(9H-fluoren-9-ylmethoxycarbonylcarbamothioylamino)heptyl]carbamate |
|---|---|
| PubChem CID | 170367360 |
| Molecular Formula | C28H37N3O4S |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | tert-butyl N-[7-(9H-fluoren-9-ylmethoxycarbonylcarbamothioylamino)heptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCNC(=S)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H37N3O4S/c1-28(2,3)35-26(32)30-18-12-6-4-5-11-17-29-25(36)31-27(33)34-19-24-22-15-9-7-13-20(22)21-14-8-10-16-23(21)24/h7-10,13-16,24H,4-6,11-12,17-19H2,1-3H3,(H,30,32)(H2,29,31,33,36) |
| InChIKey | OYTMJJTXAGPQOR-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|