C34H33NO5 — CID 51341738
[4-[(4-methylphenyl)methoxy]phenyl]methyl 4-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate (PubChem CID 51341738) has the molecular formula C34H33NO5 and a molecular weight of 535.64 g/mol. Its IUPAC name is [4-[(4-methylphenyl)methoxy]phenyl]methyl 4-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate.
| Compound Name | [4-[(4-methylphenyl)methoxy]phenyl]methyl 4-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 51341738 |
| Molecular Formula | C34H33NO5 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | [4-[(4-methylphenyl)methoxy]phenyl]methyl 4-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
| SMILES | Cc1ccc(COc2ccc(COC(=O)CCCNC(=O)OCC3c4ccccc4-c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C34H33NO5/c1-24-12-14-25(15-13-24)21-38-27-18-16-26(17-19-27)22-39-33(36)11-6-20-35-34(37)40-23-32-30-9-4-2-7-28(30)29-8-3-5-10-31(29)32/h2-5,7-10,12-19,32H,6,11,20-23H2,1H3,(H,35,37) |
| InChIKey | WXNZWLDLBGWJRZ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|