C36H38N2O5 — CID 51341767
[4-[(4-methylphenyl)methoxy]phenyl]methyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate (PubChem CID 51341767) has the molecular formula C36H38N2O5 and a molecular weight of 578.71 g/mol. Its IUPAC name is [4-[(4-methylphenyl)methoxy]phenyl]methyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate.
| Compound Name | [4-[(4-methylphenyl)methoxy]phenyl]methyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 51341767 |
| Molecular Formula | C36H38N2O5 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | [4-[(4-methylphenyl)methoxy]phenyl]methyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
| SMILES | Cc1ccc(COc2ccc(COC(=O)[C@H](CCCCN)NC(=O)OCC3c4ccccc4-c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C36H38N2O5/c1-25-13-15-26(16-14-25)22-41-28-19-17-27(18-20-28)23-42-35(39)34(12-6-7-21-37)38-36(40)43-24-33-31-10-4-2-8-29(31)30-9-3-5-11-32(30)33/h2-5,8-11,13-20,33-34H,6-7,12,21-24,37H2,1H3,(H,38,40)/t34-/m0/s1 |
| InChIKey | JYVUZKTWMOSCCS-UMSFTDKQSA-N |
| XLogP | 6.65 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|