C60H58N2O10 — CID 160659828
benzyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-phenoxyhexanoate;2-(9H-fluoren-9-yloxycarbonylamino)-6-phenoxyhexanoic acid (PubChem CID 160659828) has the molecular formula C60H58N2O10 and a molecular weight of 967.13 g/mol. Its IUPAC name is benzyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-phenoxyhexanoate;2-(9H-fluoren-9-yloxycarbonylamino)-6-phenoxyhexanoic acid.
| Compound Name | benzyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-phenoxyhexanoate;2-(9H-fluoren-9-yloxycarbonylamino)-6-phenoxyhexanoic acid |
|---|---|
| PubChem CID | 160659828 |
| Molecular Formula | C60H58N2O10 |
| Molecular Weight | 967.13 g/mol |
| Exact Mass | 966.41 |
| IUPAC Name | benzyl 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-phenoxyhexanoate;2-(9H-fluoren-9-yloxycarbonylamino)-6-phenoxyhexanoic acid |
| SMILES | O=C(NC(CCCCOc1ccccc1)C(=O)O)OC1c2ccccc2-c2ccccc21.O=C(NC(CCCCOc1ccccc1)C(=O)OCc1ccccc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C34H33NO5.C26H25NO5/c36-33(39-23-25-13-3-1-4-14-25)32(21-11-12-22-38-26-15-5-2-6-16-26)35-34(37)40-24-31-29-19-9-7-17-27(29)28-18-8-10-20-30(28)31;28-25(29)23(16-8-9-17-31-18-10-2-1-3-11-18)27-26(30)32-24-21-14-6-4-12-19(21)20-13-5-7-15-22(20)24/h1-10,13-20,31-32H,11-12,21-24H2,(H,35,37);1-7,10-15,23-24H,8-9,16-17H2,(H,27,30)(H,28,29) |
| InChIKey | RLNILSXGRMNNDK-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 158.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.13 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|