C33H41NO5S — CID 145301753
benzyl 5-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate (PubChem CID 145301753) has the molecular formula C33H41NO5S and a molecular weight of 563.76 g/mol. Its IUPAC name is benzyl 5-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate.
| Compound Name | benzyl 5-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 145301753 |
| Molecular Formula | C33H41NO5S |
| Molecular Weight | 563.76 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | benzyl 5-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoate |
| SMILES | CC(C)(C)S(C)(C)OCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H41NO5S/c1-33(2,3)40(4,5)39-21-13-20-30(31(35)37-22-24-14-7-6-8-15-24)34-32(36)38-23-29-27-18-11-9-16-25(27)26-17-10-12-19-28(26)29/h6-12,14-19,29-30H,13,20-23H2,1-5H3,(H,34,36) |
| InChIKey | HFFVNZXTERRWQO-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.76 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|