C28H41NO5S — CID 145301788
5-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid;ethane (PubChem CID 145301788) has the molecular formula C28H41NO5S and a molecular weight of 503.71 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid;ethane.
| Compound Name | 5-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid;ethane |
|---|---|
| PubChem CID | 145301788 |
| Molecular Formula | C28H41NO5S |
| Molecular Weight | 503.71 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | 5-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid;ethane |
| SMILES | CC.CC(C)(C)S(C)(C)OCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C26H35NO5S.C2H6/c1-26(2,3)33(4,5)32-16-10-15-23(24(28)29)27-25(30)31-17-22-20-13-8-6-11-18(20)19-12-7-9-14-21(19)22;1-2/h6-9,11-14,22-23H,10,15-17H2,1-5H3,(H,27,30)(H,28,29);1-2H3 |
| InChIKey | FPYYSRFAQJIGPE-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.71 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|