C43H46N2O9 — CID 166162374
dibenzyl (2S)-2-[[(4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]pentanedioate (PubChem CID 166162374) has the molecular formula C43H46N2O9 and a molecular weight of 734.85 g/mol. Its IUPAC name is dibenzyl (2S)-2-[[(4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]pentanedioate.
| Compound Name | dibenzyl (2S)-2-[[(4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 166162374 |
| Molecular Formula | C43H46N2O9 |
| Molecular Weight | 734.85 g/mol |
| Exact Mass | 734.32 |
| IUPAC Name | dibenzyl (2S)-2-[[(4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoyl]amino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCC(=O)N[C@@H](CCC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C43H46N2O9/c1-43(2,3)54-41(49)37(45-42(50)53-28-35-33-20-12-10-18-31(33)32-19-11-13-21-34(32)35)22-24-38(46)44-36(40(48)52-27-30-16-8-5-9-17-30)23-25-39(47)51-26-29-14-6-4-7-15-29/h4-21,35-37H,22-28H2,1-3H3,(H,44,46)(H,45,50)/t36-,37-/m0/s1 |
| InChIKey | LSGNNUIWZGKLOP-BCRBLDSWSA-N |
| XLogP | 6.77 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.85 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|