C30H35NO5 — CID 51341620
methane;(4-methoxyphenyl)methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate (PubChem CID 51341620) has the molecular formula C30H35NO5 and a molecular weight of 489.61 g/mol. Its IUPAC name is methane;(4-methoxyphenyl)methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate.
| Compound Name | methane;(4-methoxyphenyl)methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 51341620 |
| Molecular Formula | C30H35NO5 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | methane;(4-methoxyphenyl)methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
| SMILES | C.CCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C29H31NO5.CH4/c1-3-4-13-27(28(31)34-18-20-14-16-21(33-2)17-15-20)30-29(32)35-19-26-24-11-7-5-9-22(24)23-10-6-8-12-25(23)26;/h5-12,14-17,26-27H,3-4,13,18-19H2,1-2H3,(H,30,32);1H4/t27-;/m0./s1 |
| InChIKey | HIEVIARLXUGHFC-YCBFMBTMSA-N |
| XLogP | 6.47 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |