C29H29NO7 — CID 67865485
(2S)-4-[3-(9H-fluoren-9-ylmethoxy)-3-oxopropoxy]-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 67865485) has the molecular formula C29H29NO7 and a molecular weight of 503.55 g/mol. Its IUPAC name is (2S)-4-[3-(9H-fluoren-9-ylmethoxy)-3-oxopropoxy]-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | (2S)-4-[3-(9H-fluoren-9-ylmethoxy)-3-oxopropoxy]-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 67865485 |
| Molecular Formula | C29H29NO7 |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (2S)-4-[3-(9H-fluoren-9-ylmethoxy)-3-oxopropoxy]-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | O=C(CCOCC[C@H](NC(=O)OCc1ccccc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H29NO7/c31-27(36-19-25-23-12-6-4-10-21(23)22-11-5-7-13-24(22)25)15-17-35-16-14-26(28(32)33)30-29(34)37-18-20-8-2-1-3-9-20/h1-13,25-26H,14-19H2,(H,30,34)(H,32,33)/t26-/m0/s1 |
| InChIKey | DKCWNICETOJUJN-SANMLTNESA-N |
| XLogP | 4.52 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|