C40H37N3O5 — CID 58612576
2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl-[2-(tritylamino)acetyl]amino]acetic acid (PubChem CID 58612576) has the molecular formula C40H37N3O5 and a molecular weight of 639.75 g/mol. Its IUPAC name is 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl-[2-(tritylamino)acetyl]amino]acetic acid.
| Compound Name | 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl-[2-(tritylamino)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 58612576 |
| Molecular Formula | C40H37N3O5 |
| Molecular Weight | 639.75 g/mol |
| Exact Mass | 639.27 |
| IUPAC Name | 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl-[2-(tritylamino)acetyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)CNC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H37N3O5/c44-37(26-42-40(29-14-4-1-5-15-29,30-16-6-2-7-17-30)31-18-8-3-9-19-31)43(27-38(45)46)25-24-41-39(47)48-28-36-34-22-12-10-20-32(34)33-21-11-13-23-35(33)36/h1-23,36,42H,24-28H2,(H,41,47)(H,45,46) |
| InChIKey | JXKZFHRGDAYCTG-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.75 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|