C50H58N2O10 — CID 152751889
2-[2-[2-[2-[9H-fluoren-9-ylmethoxycarbonyl-[2-[2-[2-[2-(tritylamino)ethoxy]ethoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 152751889) has the molecular formula C50H58N2O10 and a molecular weight of 847.02 g/mol. Its IUPAC name is 2-[2-[2-[2-[9H-fluoren-9-ylmethoxycarbonyl-[2-[2-[2-[2-(tritylamino)ethoxy]ethoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[9H-fluoren-9-ylmethoxycarbonyl-[2-[2-[2-[2-(tritylamino)ethoxy]ethoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 152751889 |
| Molecular Formula | C50H58N2O10 |
| Molecular Weight | 847.02 g/mol |
| Exact Mass | 846.41 |
| IUPAC Name | 2-[2-[2-[2-[9H-fluoren-9-ylmethoxycarbonyl-[2-[2-[2-[2-(tritylamino)ethoxy]ethoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCCOCCN(CCOCCOCCOCCNC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C50H58N2O10/c53-48(54)39-61-37-36-60-35-32-58-29-26-52(49(55)62-38-47-45-22-12-10-20-43(45)44-21-11-13-23-46(44)47)25-28-57-31-34-59-33-30-56-27-24-51-50(40-14-4-1-5-15-40,41-16-6-2-7-17-41)42-18-8-3-9-19-42/h1-23,47,51H,24-39H2,(H,53,54) |
| InChIKey | CKOYBLJNXCXDOR-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.02 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|