C39H56N2O12 — CID 70041299
prop-2-enyl 2-[2-[2-[2-[9H-fluoren-9-ylmethoxycarbonyl-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]ethoxy]acetate (PubChem CID 70041299) has the molecular formula C39H56N2O12 and a molecular weight of 744.88 g/mol. Its IUPAC name is prop-2-enyl 2-[2-[2-[2-[9H-fluoren-9-ylmethoxycarbonyl-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]ethoxy]acetate.
| Compound Name | prop-2-enyl 2-[2-[2-[2-[9H-fluoren-9-ylmethoxycarbonyl-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 70041299 |
| Molecular Formula | C39H56N2O12 |
| Molecular Weight | 744.88 g/mol |
| Exact Mass | 744.38 |
| IUPAC Name | prop-2-enyl 2-[2-[2-[2-[9H-fluoren-9-ylmethoxycarbonyl-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethyl]amino]ethoxy]ethoxy]ethoxy]acetate |
| SMILES | C=CCOC(=O)COCCOCCOCCN(CCOCCOCCOCCNC(=O)OC(C)(C)C)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C39H56N2O12/c1-5-17-51-36(42)30-50-28-27-49-26-23-47-20-16-41(15-19-46-22-25-48-24-21-45-18-14-40-37(43)53-39(2,3)4)38(44)52-29-35-33-12-8-6-10-31(33)32-11-7-9-13-34(32)35/h5-13,35H,1,14-30H2,2-4H3,(H,40,43) |
| InChIKey | PDQDKZDRSYOBAL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 149.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.88 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|