C37H53NO8 — CID 142159487
tert-butyl N-[2-(2-propoxyethoxy)ethyl]carbamate;9H-fluoren-9-ylmethyl 2-[2-(2-cyclobutylidenepropoxy)ethoxy]acetate (PubChem CID 142159487) has the molecular formula C37H53NO8 and a molecular weight of 639.83 g/mol. Its IUPAC name is tert-butyl N-[2-(2-propoxyethoxy)ethyl]carbamate;9H-fluoren-9-ylmethyl 2-[2-(2-cyclobutylidenepropoxy)ethoxy]acetate.
| Compound Name | tert-butyl N-[2-(2-propoxyethoxy)ethyl]carbamate;9H-fluoren-9-ylmethyl 2-[2-(2-cyclobutylidenepropoxy)ethoxy]acetate |
|---|---|
| PubChem CID | 142159487 |
| Molecular Formula | C37H53NO8 |
| Molecular Weight | 639.83 g/mol |
| Exact Mass | 639.38 |
| IUPAC Name | tert-butyl N-[2-(2-propoxyethoxy)ethyl]carbamate;9H-fluoren-9-ylmethyl 2-[2-(2-cyclobutylidenepropoxy)ethoxy]acetate |
| SMILES | CC(COCCOCC(=O)OCC1c2ccccc2-c2ccccc21)=C1CCC1.CCCOCCOCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H28O4.C12H25NO4/c1-18(19-7-6-8-19)15-27-13-14-28-17-25(26)29-16-24-22-11-4-2-9-20(22)21-10-3-5-12-23(21)24;1-5-7-15-9-10-16-8-6-13-11(14)17-12(2,3)4/h2-5,9-12,24H,6-8,13-17H2,1H3;5-10H2,1-4H3,(H,13,14) |
| InChIKey | SLSJYQNGBKUQEB-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.83 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|