C27H38N2O7 — CID 154803547
9H-fluoren-9-ylmethyl N-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 154803547) has the molecular formula C27H38N2O7 and a molecular weight of 502.61 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 154803547 |
| Molecular Formula | C27H38N2O7 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | NCCOCCOCCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H38N2O7/c28-9-11-31-13-15-33-17-19-35-20-18-34-16-14-32-12-10-29-27(30)36-21-26-24-7-3-1-5-22(24)23-6-2-4-8-25(23)26/h1-8,26H,9-21,28H2,(H,29,30) |
| InChIKey | MPOMUBRLMOQWHJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|