C30H39NO8 — CID 170901439
9H-fluoren-9-ylmethyl N-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 170901439) has the molecular formula C30H39NO8 and a molecular weight of 541.64 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 170901439 |
| Molecular Formula | C30H39NO8 |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | C#CCOCCOCCOCCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C30H39NO8/c1-2-12-33-14-16-35-18-20-37-22-23-38-21-19-36-17-15-34-13-11-31-30(32)39-24-29-27-9-5-3-7-25(27)26-8-4-6-10-28(26)29/h1,3-10,29H,11-24H2,(H,31,32) |
| InChIKey | UCWMPWFRDCMJEG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|