C39H54N2O11 — CID 122696603
tert-butyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]pentanoate (PubChem CID 122696603) has the molecular formula C39H54N2O11 and a molecular weight of 726.86 g/mol. Its IUPAC name is tert-butyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]pentanoate.
| Compound Name | tert-butyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]pentanoate |
|---|---|
| PubChem CID | 122696603 |
| Molecular Formula | C39H54N2O11 |
| Molecular Weight | 726.86 g/mol |
| Exact Mass | 726.37 |
| IUPAC Name | tert-butyl (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]pentanoate |
| SMILES | C#CCOCCOCCOCCOCCOCCOCCNC(=O)CC[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C39H54N2O11/c1-5-17-45-19-21-47-23-25-49-27-28-50-26-24-48-22-20-46-18-16-40-36(42)15-14-35(37(43)52-39(2,3)4)41-38(44)51-29-34-32-12-8-6-10-30(32)31-11-7-9-13-33(31)34/h1,6-13,34-35H,14-29H2,2-4H3,(H,40,42)(H,41,44)/t35-/m1/s1 |
| InChIKey | ZDQJUPGBOARXHU-PGUFJCEWSA-N |
| XLogP | 3.86 |
| TPSA | 149.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.86 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|