C35H55N3O10 — CID 178135145
9H-fluoren-9-ylmethyl N,N-bis[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 178135145) has the molecular formula C35H55N3O10 and a molecular weight of 677.84 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N,N-bis[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N,N-bis[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 178135145 |
| Molecular Formula | C35H55N3O10 |
| Molecular Weight | 677.84 g/mol |
| Exact Mass | 677.39 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N,N-bis[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | NCCOCCOCCOCCOCCN(CCOCCOCCOCCOCCN)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C35H55N3O10/c36-9-13-40-17-21-44-25-27-46-23-19-42-15-11-38(12-16-43-20-24-47-28-26-45-22-18-41-14-10-37)35(39)48-29-34-32-7-3-1-5-30(32)31-6-2-4-8-33(31)34/h1-8,34H,9-29,36-37H2 |
| InChIKey | IYPSQJMKWCPJOQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 155.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.84 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|