C21H27ClN2O4 — CID 75492694
methyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-N-(9H-fluoren-9-yl)carbamate;hydrochloride (PubChem CID 75492694) has the molecular formula C21H27ClN2O4 and a molecular weight of 406.91 g/mol. Its IUPAC name is methyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-N-(9H-fluoren-9-yl)carbamate;hydrochloride.
| Compound Name | methyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-N-(9H-fluoren-9-yl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 75492694 |
| Molecular Formula | C21H27ClN2O4 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | methyl N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-N-(9H-fluoren-9-yl)carbamate;hydrochloride |
| SMILES | COC(=O)N(CCOCCOCCN)C1c2ccccc2-c2ccccc21.Cl |
| InChI | InChI=1S/C21H26N2O4.ClH/c1-25-21(24)23(11-13-27-15-14-26-12-10-22)20-18-8-4-2-6-16(18)17-7-3-5-9-19(17)20;/h2-9,20H,10-15,22H2,1H3;1H |
| InChIKey | OBGXCIXOKALNMA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|