C26H33NO8 — CID 67304548
3-[2-[2-[2-[2-[9H-fluoren-9-yl(methoxycarbonyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 67304548) has the molecular formula C26H33NO8 and a molecular weight of 487.55 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[9H-fluoren-9-yl(methoxycarbonyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[2-[2-[9H-fluoren-9-yl(methoxycarbonyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 67304548 |
| Molecular Formula | C26H33NO8 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 3-[2-[2-[2-[2-[9H-fluoren-9-yl(methoxycarbonyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | COC(=O)N(CCOCCOCCOCCOCCC(=O)O)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H33NO8/c1-31-26(30)27(25-22-8-4-2-6-20(22)21-7-3-5-9-23(21)25)11-13-33-15-17-35-19-18-34-16-14-32-12-10-24(28)29/h2-9,25H,10-19H2,1H3,(H,28,29) |
| InChIKey | OQLVMEBMBIXWOM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|