C25H23NO4 — CID 53394977
3-[9H-fluoren-9-yl(methoxycarbonyl)amino]-4-phenylbutanoic acid (PubChem CID 53394977) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is 3-[9H-fluoren-9-yl(methoxycarbonyl)amino]-4-phenylbutanoic acid.
| Compound Name | 3-[9H-fluoren-9-yl(methoxycarbonyl)amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 53394977 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 3-[9H-fluoren-9-yl(methoxycarbonyl)amino]-4-phenylbutanoic acid |
| SMILES | COC(=O)N(C(CC(=O)O)Cc1ccccc1)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H23NO4/c1-30-25(29)26(18(16-23(27)28)15-17-9-3-2-4-10-17)24-21-13-7-5-11-19(21)20-12-6-8-14-22(20)24/h2-14,18,24H,15-16H2,1H3,(H,27,28) |
| InChIKey | QGIIVADDRVKKQC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |