C26H24ClNO4 — CID 146596692
4-(4-chlorophenyl)-3-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid (PubChem CID 146596692) has the molecular formula C26H24ClNO4 and a molecular weight of 449.93 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid.
| Compound Name | 4-(4-chlorophenyl)-3-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid |
|---|---|
| PubChem CID | 146596692 |
| Molecular Formula | C26H24ClNO4 |
| Molecular Weight | 449.93 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 4-(4-chlorophenyl)-3-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoic acid |
| SMILES | CN(C(=O)OCC1c2ccccc2-c2ccccc21)C(CC(=O)O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H24ClNO4/c1-28(19(15-25(29)30)14-17-10-12-18(27)13-11-17)26(31)32-16-24-22-8-4-2-6-20(22)21-7-3-5-9-23(21)24/h2-13,19,24H,14-16H2,1H3,(H,29,30) |
| InChIKey | CPHYARLXGSOBIJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.93 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |