C25H22ClNO4 — CID 165470059
(2S)-2-[(4-chlorophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid (PubChem CID 165470059) has the molecular formula C25H22ClNO4 and a molecular weight of 435.91 g/mol. Its IUPAC name is (2S)-2-[(4-chlorophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid.
| Compound Name | (2S)-2-[(4-chlorophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 165470059 |
| Molecular Formula | C25H22ClNO4 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | (2S)-2-[(4-chlorophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid |
| SMILES | C[C@@H](C(=O)O)N(Cc1ccc(Cl)cc1)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H22ClNO4/c1-16(24(28)29)27(14-17-10-12-18(26)13-11-17)25(30)31-15-23-21-8-4-2-6-19(21)20-7-3-5-9-22(20)23/h2-13,16,23H,14-15H2,1H3,(H,28,29)/t16-/m0/s1 |
| InChIKey | FWJQXXRFBUKYKA-INIZCTEOSA-N |
| XLogP | 5.56 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |