C27H26ClNO4 — CID 165470994
2-[(2-chlorophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-methylbutanoic acid (PubChem CID 165470994) has the molecular formula C27H26ClNO4 and a molecular weight of 463.96 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-methylbutanoic acid.
| Compound Name | 2-[(2-chlorophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 165470994 |
| Molecular Formula | C27H26ClNO4 |
| Molecular Weight | 463.96 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)N(Cc1ccccc1Cl)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H26ClNO4/c1-17(2)25(26(30)31)29(15-18-9-3-8-14-24(18)28)27(32)33-16-23-21-12-6-4-10-19(21)20-11-5-7-13-22(20)23/h3-14,17,23,25H,15-16H2,1-2H3,(H,30,31) |
| InChIKey | JAIBGUYSXRVUMQ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.96 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |