C24H24N2O6 — CID 90120158
(2S)-2-[(2,5-dioxopyrrolidin-1-yl)-(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-methylbutanoic acid (PubChem CID 90120158) has the molecular formula C24H24N2O6 and a molecular weight of 436.46 g/mol. Its IUPAC name is (2S)-2-[(2,5-dioxopyrrolidin-1-yl)-(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[(2,5-dioxopyrrolidin-1-yl)-(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 90120158 |
| Molecular Formula | C24H24N2O6 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | (2S)-2-[(2,5-dioxopyrrolidin-1-yl)-(9H-fluoren-9-ylmethoxycarbonyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](C(=O)O)N(C(=O)OCC1c2ccccc2-c2ccccc21)N1C(=O)CCC1=O |
| InChI | InChI=1S/C24H24N2O6/c1-14(2)22(23(29)30)26(25-20(27)11-12-21(25)28)24(31)32-13-19-17-9-5-3-7-15(17)16-8-4-6-10-18(16)19/h3-10,14,19,22H,11-13H2,1-2H3,(H,29,30)/t22-/m0/s1 |
| InChIKey | OBSOWKYSPJNPBR-QFIPXVFZSA-N |
| XLogP | 3.41 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|