C27H27NO4 — CID 177277596
(4R)-4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-5-phenylpentanoic acid (PubChem CID 177277596) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is (4R)-4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-5-phenylpentanoic acid.
| Compound Name | (4R)-4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 177277596 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (4R)-4-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-5-phenylpentanoic acid |
| SMILES | CN(C(=O)OCC1c2ccccc2-c2ccccc21)[C@H](CCC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C27H27NO4/c1-28(20(15-16-26(29)30)17-19-9-3-2-4-10-19)27(31)32-18-25-23-13-7-5-11-21(23)22-12-6-8-14-24(22)25/h2-14,20,25H,15-18H2,1H3,(H,29,30)/t20-/m1/s1 |
| InChIKey | YYFILSOINXSJSI-HXUWFJFHSA-N |
| XLogP | 5.34 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |