C21H22ClNO3 — CID 176832325
9H-fluoren-9-ylmethyl N-[(2S)-1-chloro-1-oxopentan-2-yl]-N-methylcarbamate (PubChem CID 176832325) has the molecular formula C21H22ClNO3 and a molecular weight of 371.86 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-1-chloro-1-oxopentan-2-yl]-N-methylcarbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-chloro-1-oxopentan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 176832325 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-chloro-1-oxopentan-2-yl]-N-methylcarbamate |
| SMILES | CCC[C@@H](C(=O)Cl)N(C)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H22ClNO3/c1-3-8-19(20(22)24)23(2)21(25)26-13-18-16-11-6-4-9-14(16)15-10-5-7-12-17(15)18/h4-7,9-12,18-19H,3,8,13H2,1-2H3/t19-/m0/s1 |
| InChIKey | XVJWAXMDZCMHJR-IBGZPJMESA-N |
| XLogP | 4.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|