About methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate
methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate (PubChem CID 87088133) has the molecular formula C31H36N2O5
and a molecular weight of 516.64 g/mol. Its IUPAC name is methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate.
Molecular Properties
| Compound Name | methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate |
| PubChem CID | 87088133 |
| Molecular Formula | C31H36N2O5 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate |
| SMILES | CCOC(CN(Cc1ccccc1)CC(C=O)N(C(=O)OC)C1c2ccccc2-c2ccccc21)OCC |
| InChI | InChI=1S/C31H36N2O5/c1-4-37-29(38-5-2)21-32(19-23-13-7-6-8-14-23)20-24(22-34)33(31(35)36-3)30-27-17-11-9-15-25(27)26-16-10-12-18-28(26)30/h6-18,22,24,29-30H,4-5,19-21H2,1-3H3 |
| InChIKey | PTGWRQBZDQGLST-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate?
The IUPAC name of methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate (CID 87088133) is methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate.
What is the SMILES notation for methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate?
The canonical SMILES for methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate is CCOC(CN(Cc1ccccc1)CC(C=O)N(C(=O)OC)C1c2ccccc2-c2ccccc21)OCC.
What is the InChIKey of methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate?
The InChIKey is PTGWRQBZDQGLST-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H36N2O5/c1-4-37-29(38-5-2)21-32(19-23-13-7-6-8-14-23)20-24(22-34)33(31(35)36-3)30-27-17-11-9-15-25(27)26-16-10-12-18-28(26)30/h6-18,22,24,29-30H,4-5,19-21H2,1-3H3.
What are the key properties of methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate?
methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate has a molecular weight of 516.64 g/mol, XLogP of 5.29, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate is sourced from PubChem (CID 87088133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).