C31H36N2O5 — CID 87088133
methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate (PubChem CID 87088133) has the molecular formula C31H36N2O5 and a molecular weight of 516.64 g/mol. Its IUPAC name is methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate.
| Compound Name | methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate |
|---|---|
| PubChem CID | 87088133 |
| Molecular Formula | C31H36N2O5 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | methyl N-[1-[benzyl(2,2-diethoxyethyl)amino]-3-oxopropan-2-yl]-N-(9H-fluoren-9-yl)carbamate |
| SMILES | CCOC(CN(Cc1ccccc1)CC(C=O)N(C(=O)OC)C1c2ccccc2-c2ccccc21)OCC |
| InChI | InChI=1S/C31H36N2O5/c1-4-37-29(38-5-2)21-32(19-23-13-7-6-8-14-23)20-24(22-34)33(31(35)36-3)30-27-17-11-9-15-25(27)26-16-10-12-18-28(26)30/h6-18,22,24,29-30H,4-5,19-21H2,1-3H3 |
| InChIKey | PTGWRQBZDQGLST-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|