C17H25NO5 — CID 67447375
4-[benzyl(2,2-diethoxyethyl)amino]-4-oxobutanoic acid (PubChem CID 67447375) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is 4-[benzyl(2,2-diethoxyethyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-[benzyl(2,2-diethoxyethyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67447375 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 4-[benzyl(2,2-diethoxyethyl)amino]-4-oxobutanoic acid |
| SMILES | CCOC(CN(Cc1ccccc1)C(=O)CCC(=O)O)OCC |
| InChI | InChI=1S/C17H25NO5/c1-3-22-17(23-4-2)13-18(15(19)10-11-16(20)21)12-14-8-6-5-7-9-14/h5-9,17H,3-4,10-13H2,1-2H3,(H,20,21) |
| InChIKey | SQQJFKZTUIYULM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|