C15H25N3O3 — CID 163240446
(2S)-2-amino-N-(2,2-diethoxyethyl)-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 163240446) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is (2S)-2-amino-N-(2,2-diethoxyethyl)-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | (2S)-2-amino-N-(2,2-diethoxyethyl)-N-(pyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 163240446 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (2S)-2-amino-N-(2,2-diethoxyethyl)-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | CCOC(CN(Cc1ccncc1)C(=O)[C@H](C)N)OCC |
| InChI | InChI=1S/C15H25N3O3/c1-4-20-14(21-5-2)11-18(15(19)12(3)16)10-13-6-8-17-9-7-13/h6-9,12,14H,4-5,10-11,16H2,1-3H3/t12-/m0/s1 |
| InChIKey | AXQWLCRDGCZVLW-LBPRGKRZSA-N |
| XLogP | 1.16 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|