C13H20ClN3O3 — CID 120873027
methyl 3-[[(2R)-2-aminopropanoyl]-(pyridin-4-ylmethyl)amino]propanoate;hydrochloride (PubChem CID 120873027) has the molecular formula C13H20ClN3O3 and a molecular weight of 301.77 g/mol. Its IUPAC name is methyl 3-[[(2R)-2-aminopropanoyl]-(pyridin-4-ylmethyl)amino]propanoate;hydrochloride.
| Compound Name | methyl 3-[[(2R)-2-aminopropanoyl]-(pyridin-4-ylmethyl)amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 120873027 |
| Molecular Formula | C13H20ClN3O3 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | methyl 3-[[(2R)-2-aminopropanoyl]-(pyridin-4-ylmethyl)amino]propanoate;hydrochloride |
| SMILES | COC(=O)CCN(Cc1ccncc1)C(=O)[C@@H](C)N.Cl |
| InChI | InChI=1S/C13H19N3O3.ClH/c1-10(14)13(18)16(8-5-12(17)19-2)9-11-3-6-15-7-4-11;/h3-4,6-7,10H,5,8-9,14H2,1-2H3;1H/t10-;/m1./s1 |
| InChIKey | PENMLCIQAMIWTQ-HNCPQSOCSA-N |
| XLogP | 0.74 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |