C21H24N2O4 — CID 75534426
methyl 3-[[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]-(pyridin-4-ylmethyl)amino]propanoate (PubChem CID 75534426) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is methyl 3-[[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]-(pyridin-4-ylmethyl)amino]propanoate.
| Compound Name | methyl 3-[[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]-(pyridin-4-ylmethyl)amino]propanoate |
|---|---|
| PubChem CID | 75534426 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | methyl 3-[[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]-(pyridin-4-ylmethyl)amino]propanoate |
| SMILES | CCOc1ccccc1/C=C/C(=O)N(CCC(=O)OC)Cc1ccncc1 |
| InChI | InChI=1S/C21H24N2O4/c1-3-27-19-7-5-4-6-18(19)8-9-20(24)23(15-12-21(25)26-2)16-17-10-13-22-14-11-17/h4-11,13-14H,3,12,15-16H2,1-2H3/b9-8+ |
| InChIKey | GKUCPXQMXMXGBM-CMDGGOBGSA-N |
| XLogP | 3.09 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|