C20H28N2O3 — CID 138469467
(2S)-2-amino-N-(2,2-diethoxyethyl)-N-(naphthalen-2-ylmethyl)propanamide (PubChem CID 138469467) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is (2S)-2-amino-N-(2,2-diethoxyethyl)-N-(naphthalen-2-ylmethyl)propanamide.
| Compound Name | (2S)-2-amino-N-(2,2-diethoxyethyl)-N-(naphthalen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 138469467 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (2S)-2-amino-N-(2,2-diethoxyethyl)-N-(naphthalen-2-ylmethyl)propanamide |
| SMILES | CCOC(CN(Cc1ccc2ccccc2c1)C(=O)[C@H](C)N)OCC |
| InChI | InChI=1S/C20H28N2O3/c1-4-24-19(25-5-2)14-22(20(23)15(3)21)13-16-10-11-17-8-6-7-9-18(17)12-16/h6-12,15,19H,4-5,13-14,21H2,1-3H3/t15-/m0/s1 |
| InChIKey | KLVFTXNHHQFYJB-HNNXBMFYSA-N |
| XLogP | 2.91 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|