C18H24N2O — CID 60938303
2-amino-N,4-dimethyl-N-(naphthalen-2-ylmethyl)pentanamide (PubChem CID 60938303) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-amino-N,4-dimethyl-N-(naphthalen-2-ylmethyl)pentanamide.
| Compound Name | 2-amino-N,4-dimethyl-N-(naphthalen-2-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 60938303 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-amino-N,4-dimethyl-N-(naphthalen-2-ylmethyl)pentanamide |
| SMILES | CC(C)CC(N)C(=O)N(C)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H24N2O/c1-13(2)10-17(19)18(21)20(3)12-14-8-9-15-6-4-5-7-16(15)11-14/h4-9,11,13,17H,10,12,19H2,1-3H3 |
| InChIKey | SDTXLKZXYRUEPD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |