C17H22N2O — CID 79013131
(2R)-2-amino-N,3-dimethyl-N-(naphthalen-2-ylmethyl)butanamide (PubChem CID 79013131) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (2R)-2-amino-N,3-dimethyl-N-(naphthalen-2-ylmethyl)butanamide.
| Compound Name | (2R)-2-amino-N,3-dimethyl-N-(naphthalen-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 79013131 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (2R)-2-amino-N,3-dimethyl-N-(naphthalen-2-ylmethyl)butanamide |
| SMILES | CC(C)[C@@H](N)C(=O)N(C)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H22N2O/c1-12(2)16(18)17(20)19(3)11-13-8-9-14-6-4-5-7-15(14)10-13/h4-10,12,16H,11,18H2,1-3H3/t16-/m1/s1 |
| InChIKey | WBWXWDHVFIBYPK-MRXNPFEDSA-N |
| XLogP | 2.78 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |