C16H18BrNO — CID 114328072
2-bromo-N,2-dimethyl-N-(naphthalen-2-ylmethyl)propanamide (PubChem CID 114328072) has the molecular formula C16H18BrNO and a molecular weight of 320.23 g/mol. Its IUPAC name is 2-bromo-N,2-dimethyl-N-(naphthalen-2-ylmethyl)propanamide.
| Compound Name | 2-bromo-N,2-dimethyl-N-(naphthalen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 114328072 |
| Molecular Formula | C16H18BrNO |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-bromo-N,2-dimethyl-N-(naphthalen-2-ylmethyl)propanamide |
| SMILES | CN(Cc1ccc2ccccc2c1)C(=O)C(C)(C)Br |
| InChI | InChI=1S/C16H18BrNO/c1-16(2,17)15(19)18(3)11-12-8-9-13-6-4-5-7-14(13)10-12/h4-10H,11H2,1-3H3 |
| InChIKey | OEOCNMMSLCMUPZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|