C22H23FN2O — CID 27073013
N-[(4-fluorophenyl)methyl]-N-methyl-2-[methyl(naphthalen-2-ylmethyl)amino]acetamide (PubChem CID 27073013) has the molecular formula C22H23FN2O and a molecular weight of 350.44 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-methyl-2-[methyl(naphthalen-2-ylmethyl)amino]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-methyl-2-[methyl(naphthalen-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 27073013 |
| Molecular Formula | C22H23FN2O |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-methyl-2-[methyl(naphthalen-2-ylmethyl)amino]acetamide |
| SMILES | CN(CC(=O)N(C)Cc1ccc(F)cc1)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H23FN2O/c1-24(14-18-7-10-19-5-3-4-6-20(19)13-18)16-22(26)25(2)15-17-8-11-21(23)12-9-17/h3-13H,14-16H2,1-2H3 |
| InChIKey | HZMJXIHQXSFEFZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |