C15H25N3O — CID 79013489
(2R)-2-amino-N-[[4-(dimethylamino)phenyl]methyl]-N,3-dimethylbutanamide (PubChem CID 79013489) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is (2R)-2-amino-N-[[4-(dimethylamino)phenyl]methyl]-N,3-dimethylbutanamide.
| Compound Name | (2R)-2-amino-N-[[4-(dimethylamino)phenyl]methyl]-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 79013489 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | (2R)-2-amino-N-[[4-(dimethylamino)phenyl]methyl]-N,3-dimethylbutanamide |
| SMILES | CC(C)[C@@H](N)C(=O)N(C)Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C15H25N3O/c1-11(2)14(16)15(19)18(5)10-12-6-8-13(9-7-12)17(3)4/h6-9,11,14H,10,16H2,1-5H3/t14-/m1/s1 |
| InChIKey | GRALFOZJMNNENB-CQSZACIVSA-N |
| XLogP | 1.69 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|